C17H11F3N2OS — CID 112990152
N-[4-(2,3,4-trifluoroanilino)phenyl]thiophene-2-carboxamide (PubChem CID 112990152) has the molecular formula C17H11F3N2OS and a molecular weight of 348.35 g/mol. Its IUPAC name is N-[4-(2,3,4-trifluoroanilino)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(2,3,4-trifluoroanilino)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112990152 |
| Molecular Formula | C17H11F3N2OS |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N-[4-(2,3,4-trifluoroanilino)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(F)c(F)c2F)cc1)c1cccs1 |
| InChI | InChI=1S/C17H11F3N2OS/c18-12-7-8-13(16(20)15(12)19)21-10-3-5-11(6-4-10)22-17(23)14-2-1-9-24-14/h1-9,21H,(H,22,23) |
| InChIKey | VAPVSIRUZQRHGU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|