C28H16F4N2O4S2 — CID 2307498
N-[4-[2,3,5,6-tetrafluoro-4-[4-(thiophene-2-carbonylamino)phenoxy]phenoxy]phenyl]thiophene-2-carboxamide (PubChem CID 2307498) has the molecular formula C28H16F4N2O4S2 and a molecular weight of 584.57 g/mol. Its IUPAC name is N-[4-[2,3,5,6-tetrafluoro-4-[4-(thiophene-2-carbonylamino)phenoxy]phenoxy]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2,3,5,6-tetrafluoro-4-[4-(thiophene-2-carbonylamino)phenoxy]phenoxy]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2307498 |
| Molecular Formula | C28H16F4N2O4S2 |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 584.05 |
| IUPAC Name | N-[4-[2,3,5,6-tetrafluoro-4-[4-(thiophene-2-carbonylamino)phenoxy]phenoxy]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2c(F)c(F)c(Oc3ccc(NC(=O)c4cccs4)cc3)c(F)c2F)cc1)c1cccs1 |
| InChI | InChI=1S/C28H16F4N2O4S2/c29-21-23(31)26(38-18-11-7-16(8-12-18)34-28(36)20-4-2-14-40-20)24(32)22(30)25(21)37-17-9-5-15(6-10-17)33-27(35)19-3-1-13-39-19/h1-14H,(H,33,35)(H,34,36) |
| InChIKey | KMQDKIAELJGCGN-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|