C15H12FN3O2S — CID 47090311
N-(4-fluoro-1H-indazol-3-yl)-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 47090311) has the molecular formula C15H12FN3O2S and a molecular weight of 317.34 g/mol. Its IUPAC name is N-(4-fluoro-1H-indazol-3-yl)-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-(4-fluoro-1H-indazol-3-yl)-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 47090311 |
| Molecular Formula | C15H12FN3O2S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(4-fluoro-1H-indazol-3-yl)-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCC(=O)c1cccs1)Nc1n[nH]c2cccc(F)c12 |
| InChI | InChI=1S/C15H12FN3O2S/c16-9-3-1-4-10-14(9)15(19-18-10)17-13(21)7-6-11(20)12-5-2-8-22-12/h1-5,8H,6-7H2,(H2,17,18,19,21) |
| InChIKey | CCCMZOOZYCIPCU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |