C16H12F3N3OS2 — CID 110428723
3-(2-amino-4-thiophen-2-yl-1,3-thiazol-5-yl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 110428723) has the molecular formula C16H12F3N3OS2 and a molecular weight of 383.42 g/mol. Its IUPAC name is 3-(2-amino-4-thiophen-2-yl-1,3-thiazol-5-yl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-(2-amino-4-thiophen-2-yl-1,3-thiazol-5-yl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 110428723 |
| Molecular Formula | C16H12F3N3OS2 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 3-(2-amino-4-thiophen-2-yl-1,3-thiazol-5-yl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | Nc1nc(-c2cccs2)c(CCC(=O)Nc2ccc(F)c(F)c2F)s1 |
| InChI | InChI=1S/C16H12F3N3OS2/c17-8-3-4-9(14(19)13(8)18)21-12(23)6-5-11-15(22-16(20)25-11)10-2-1-7-24-10/h1-4,7H,5-6H2,(H2,20,22)(H,21,23) |
| InChIKey | FBLSJUVMLKRKTJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|