C17H15F3N3O2S+ — CID 9197707
methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]azanium (PubChem CID 9197707) has the molecular formula C17H15F3N3O2S+ and a molecular weight of 382.39 g/mol. Its IUPAC name is methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]azanium.
| Compound Name | methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 9197707 |
| Molecular Formula | C17H15F3N3O2S+ |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(F)c(F)c1F)Cc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C17H14F3N3O2S/c1-23(7-10-9-25-17(21-10)13-3-2-6-26-13)8-14(24)22-12-5-4-11(18)15(19)16(12)20/h2-6,9H,7-8H2,1H3,(H,22,24)/p+1 |
| InChIKey | ZUNKLUVVQARNJV-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|