C15H10F3N3O2S2 — CID 7981765
(2R)-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 7981765) has the molecular formula C15H10F3N3O2S2 and a molecular weight of 385.39 g/mol. Its IUPAC name is (2R)-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 7981765 |
| Molecular Formula | C15H10F3N3O2S2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | (2R)-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@@H](Sc1nnc(-c2cccs2)o1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H10F3N3O2S2/c1-7(13(22)19-9-5-4-8(16)11(17)12(9)18)25-15-21-20-14(23-15)10-3-2-6-24-10/h2-7H,1H3,(H,19,22)/t7-/m1/s1 |
| InChIKey | LHTKPQMVJPWULE-SSDOTTSWSA-N |
| XLogP | 4.33 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|