C9H10N4O2S2 — CID 63591351
2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propanehydrazide (PubChem CID 63591351) has the molecular formula C9H10N4O2S2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propanehydrazide.
| Compound Name | 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propanehydrazide |
|---|---|
| PubChem CID | 63591351 |
| Molecular Formula | C9H10N4O2S2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propanehydrazide |
| SMILES | CC(Sc1nnc(-c2cccs2)o1)C(=O)NN |
| InChI | InChI=1S/C9H10N4O2S2/c1-5(7(14)11-10)17-9-13-12-8(15-9)6-3-2-4-16-6/h2-5H,10H2,1H3,(H,11,14) |
| InChIKey | NPWFHVUIBLNMPN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|