C11H14N4O2S2 — CID 83048615
2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]pentanehydrazide (PubChem CID 83048615) has the molecular formula C11H14N4O2S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]pentanehydrazide.
| Compound Name | 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]pentanehydrazide |
|---|---|
| PubChem CID | 83048615 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]pentanehydrazide |
| SMILES | CCCC(Sc1nnc(-c2cccs2)o1)C(=O)NN |
| InChI | InChI=1S/C11H14N4O2S2/c1-2-4-7(9(16)13-12)19-11-15-14-10(17-11)8-5-3-6-18-8/h3,5-7H,2,4,12H2,1H3,(H,13,16) |
| InChIKey | XFNXZBJRIZGIPA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|