C13H15F3N7O+ — CID 9043075
(4,6-diamino-1,3,5-triazin-2-yl)methyl-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 9043075) has the molecular formula C13H15F3N7O+ and a molecular weight of 342.31 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9043075 |
| Molecular Formula | C13H15F3N7O+ |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(F)c(F)c1F)Cc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C13H14F3N7O/c1-23(4-8-20-12(17)22-13(18)21-8)5-9(24)19-7-3-2-6(14)10(15)11(7)16/h2-3H,4-5H2,1H3,(H,19,24)(H4,17,18,20,21,22)/p+1 |
| InChIKey | DGWUWXDQAOXGKV-UHFFFAOYSA-O |
| XLogP | -0.89 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|