C12H15F3N3O2+ — CID 9197525
[(2S)-1-amino-1-oxopropan-2-yl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 9197525) has the molecular formula C12H15F3N3O2+ and a molecular weight of 290.26 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9197525 |
| Molecular Formula | C12H15F3N3O2+ |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | C[C@@H](C(N)=O)[NH+](C)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H14F3N3O2/c1-6(12(16)20)18(2)5-9(19)17-8-4-3-7(13)10(14)11(8)15/h3-4,6H,5H2,1-2H3,(H2,16,20)(H,17,19)/p+1/t6-/m0/s1 |
| InChIKey | GMMCSCNPZNNEGH-LURJTMIESA-O |
| XLogP | -0.57 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|