C14H17F3N3O4+ — CID 8551035
[(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 8551035) has the molecular formula C14H17F3N3O4+ and a molecular weight of 348.30 g/mol. Its IUPAC name is [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8551035 |
| Molecular Formula | C14H17F3N3O4+ |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [(2R)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | COC(=O)NC(=O)[C@@H](C)[NH+](C)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H16F3N3O4/c1-7(13(22)19-14(23)24-3)20(2)6-10(21)18-9-5-4-8(15)11(16)12(9)17/h4-5,7H,6H2,1-3H3,(H,18,21)(H,19,22,23)/p+1/t7-/m1/s1 |
| InChIKey | BDVHDBABNHCMEQ-SSDOTTSWSA-O |
| XLogP | -0.17 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|