C15H19F3N3O4+ — CID 8905305
[2-(ethoxycarbonylamino)-2-oxoethyl]-ethyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 8905305) has the molecular formula C15H19F3N3O4+ and a molecular weight of 362.33 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl]-ethyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl]-ethyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8905305 |
| Molecular Formula | C15H19F3N3O4+ |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl]-ethyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | CCOC(=O)NC(=O)C[NH+](CC)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H18F3N3O4/c1-3-21(8-12(23)20-15(24)25-4-2)7-11(22)19-10-6-5-9(16)13(17)14(10)18/h5-6H,3-4,7-8H2,1-2H3,(H,19,22)(H,20,23,24)/p+1 |
| InChIKey | OXVYAEWNVUEPQW-UHFFFAOYSA-O |
| XLogP | 0.22 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|