C19H19Cl2F3N3O2+ — CID 2698567
[2-(3,5-dichloroanilino)-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylazanium (PubChem CID 2698567) has the molecular formula C19H19Cl2F3N3O2+ and a molecular weight of 449.28 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylazanium.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylazanium |
|---|---|
| PubChem CID | 2698567 |
| Molecular Formula | C19H19Cl2F3N3O2+ |
| Molecular Weight | 449.28 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylazanium |
| SMILES | CCC[NH+](CC(=O)Nc1cc(Cl)cc(Cl)c1)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H18Cl2F3N3O2/c1-2-5-27(9-16(28)25-13-7-11(20)6-12(21)8-13)10-17(29)26-15-4-3-14(22)18(23)19(15)24/h3-4,6-8H,2,5,9-10H2,1H3,(H,25,28)(H,26,29)/p+1 |
| InChIKey | TYDPCFOMBQFAFW-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|