C16H10Cl2F3N3O3 — CID 47043076
N'-(3,5-dichlorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]oxamide (PubChem CID 47043076) has the molecular formula C16H10Cl2F3N3O3 and a molecular weight of 420.17 g/mol. Its IUPAC name is N'-(3,5-dichlorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]oxamide.
| Compound Name | N'-(3,5-dichlorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]oxamide |
|---|---|
| PubChem CID | 47043076 |
| Molecular Formula | C16H10Cl2F3N3O3 |
| Molecular Weight | 420.17 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | N'-(3,5-dichlorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]oxamide |
| SMILES | O=C(CNC(=O)C(=O)Nc1cc(Cl)cc(Cl)c1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H10Cl2F3N3O3/c17-7-3-8(18)5-9(4-7)23-16(27)15(26)22-6-12(25)24-11-2-1-10(19)13(20)14(11)21/h1-5H,6H2,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | KIHQHDMSDUUZHF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|