C16H10F5N3O3 — CID 86995752
N'-(2,4-difluorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]oxamide (PubChem CID 86995752) has the molecular formula C16H10F5N3O3 and a molecular weight of 387.26 g/mol. Its IUPAC name is N'-(2,4-difluorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]oxamide.
| Compound Name | N'-(2,4-difluorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]oxamide |
|---|---|
| PubChem CID | 86995752 |
| Molecular Formula | C16H10F5N3O3 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | N'-(2,4-difluorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]oxamide |
| SMILES | O=C(CNC(=O)C(=O)Nc1ccc(F)cc1F)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H10F5N3O3/c17-7-1-3-10(9(19)5-7)24-16(27)15(26)22-6-12(25)23-11-4-2-8(18)13(20)14(11)21/h1-5H,6H2,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | JINHFPXUZUAXFU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|