C17H12F4N2O2 — CID 4845144
3-(4-fluorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]prop-2-enamide (PubChem CID 4845144) has the molecular formula C17H12F4N2O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]prop-2-enamide.
| Compound Name | 3-(4-fluorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 4845144 |
| Molecular Formula | C17H12F4N2O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)cc1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H12F4N2O2/c18-11-4-1-10(2-5-11)3-8-14(24)22-9-15(25)23-13-7-6-12(19)16(20)17(13)21/h1-8H,9H2,(H,22,24)(H,23,25) |
| InChIKey | QRUVGHUUQXLGOT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|