C20H15F5N2O5 — CID 29379398
[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 29379398) has the molecular formula C20H15F5N2O5 and a molecular weight of 458.34 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 29379398 |
| Molecular Formula | C20H15F5N2O5 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(OC(F)F)cc1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H15F5N2O5/c21-13-6-7-14(19(23)18(13)22)27-15(28)9-26-16(29)10-31-17(30)8-3-11-1-4-12(5-2-11)32-20(24)25/h1-8,20H,9-10H2,(H,26,29)(H,27,28)/b8-3+ |
| InChIKey | XJPZYZDSUWKANO-FPYGCLRLSA-N |
| XLogP | 3.02 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|