C16H13F3N2O2 — CID 86996766
N'-(2,4-difluorophenyl)-N-[(3-fluoro-4-methylphenyl)methyl]oxamide (PubChem CID 86996766) has the molecular formula C16H13F3N2O2 and a molecular weight of 322.29 g/mol. Its IUPAC name is N'-(2,4-difluorophenyl)-N-[(3-fluoro-4-methylphenyl)methyl]oxamide.
| Compound Name | N'-(2,4-difluorophenyl)-N-[(3-fluoro-4-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 86996766 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N'-(2,4-difluorophenyl)-N-[(3-fluoro-4-methylphenyl)methyl]oxamide |
| SMILES | Cc1ccc(CNC(=O)C(=O)Nc2ccc(F)cc2F)cc1F |
| InChI | InChI=1S/C16H13F3N2O2/c1-9-2-3-10(6-12(9)18)8-20-15(22)16(23)21-14-5-4-11(17)7-13(14)19/h2-7H,8H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | VSGYZNPUVQOVOA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|