C19H21F2N3O2 — CID 16892001
N'-(2,4-difluorophenyl)-N-[3-[4-(dimethylamino)phenyl]propyl]oxamide (PubChem CID 16892001) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is N'-(2,4-difluorophenyl)-N-[3-[4-(dimethylamino)phenyl]propyl]oxamide.
| Compound Name | N'-(2,4-difluorophenyl)-N-[3-[4-(dimethylamino)phenyl]propyl]oxamide |
|---|---|
| PubChem CID | 16892001 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N'-(2,4-difluorophenyl)-N-[3-[4-(dimethylamino)phenyl]propyl]oxamide |
| SMILES | CN(C)c1ccc(CCCNC(=O)C(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H21F2N3O2/c1-24(2)15-8-5-13(6-9-15)4-3-11-22-18(25)19(26)23-17-10-7-14(20)12-16(17)21/h5-10,12H,3-4,11H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | ONRMMPMYFXABSX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|