C16H23N3O2 — CID 16891976
N-[3-[4-(dimethylamino)phenyl]propyl]-N'-prop-2-enyloxamide (PubChem CID 16891976) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[3-[4-(dimethylamino)phenyl]propyl]-N'-prop-2-enyloxamide.
| Compound Name | N-[3-[4-(dimethylamino)phenyl]propyl]-N'-prop-2-enyloxamide |
|---|---|
| PubChem CID | 16891976 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[3-[4-(dimethylamino)phenyl]propyl]-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H23N3O2/c1-4-11-17-15(20)16(21)18-12-5-6-13-7-9-14(10-8-13)19(2)3/h4,7-10H,1,5-6,11-12H2,2-3H3,(H,17,20)(H,18,21) |
| InChIKey | QAILGJGQBOXUAA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|