C13H16N2O2 — CID 2058117
N-(2-phenylethyl)-N'-prop-2-enyloxamide (PubChem CID 2058117) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is N-(2-phenylethyl)-N'-prop-2-enyloxamide.
| Compound Name | N-(2-phenylethyl)-N'-prop-2-enyloxamide |
|---|---|
| PubChem CID | 2058117 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-(2-phenylethyl)-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C13H16N2O2/c1-2-9-14-12(16)13(17)15-10-8-11-6-4-3-5-7-11/h2-7H,1,8-10H2,(H,14,16)(H,15,17) |
| InChIKey | PLLIJYRPSUDSLX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|