C15H21N3O2 — CID 16891475
N-[2-[4-(dimethylamino)phenyl]ethyl]-N'-prop-2-enyloxamide (PubChem CID 16891475) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]ethyl]-N'-prop-2-enyloxamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]ethyl]-N'-prop-2-enyloxamide |
|---|---|
| PubChem CID | 16891475 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]ethyl]-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C15H21N3O2/c1-4-10-16-14(19)15(20)17-11-9-12-5-7-13(8-6-12)18(2)3/h4-8H,1,9-11H2,2-3H3,(H,16,19)(H,17,20) |
| InChIKey | KWGAERNICQPEKU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|