C22H29FN4O2 — CID 7639205
N'-[(2R)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-N-[2-(4-fluorophenyl)ethyl]oxamide (PubChem CID 7639205) has the molecular formula C22H29FN4O2 and a molecular weight of 400.50 g/mol. Its IUPAC name is N'-[(2R)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-N-[2-(4-fluorophenyl)ethyl]oxamide.
| Compound Name | N'-[(2R)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-N-[2-(4-fluorophenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 7639205 |
| Molecular Formula | C22H29FN4O2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N'-[(2R)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-N-[2-(4-fluorophenyl)ethyl]oxamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)C(=O)NCCc2ccc(F)cc2)N(C)C)cc1 |
| InChI | InChI=1S/C22H29FN4O2/c1-26(2)19-11-7-17(8-12-19)20(27(3)4)15-25-22(29)21(28)24-14-13-16-5-9-18(23)10-6-16/h5-12,20H,13-15H2,1-4H3,(H,24,28)(H,25,29)/t20-/m0/s1 |
| InChIKey | QJRNEAYHHRIEGA-FQEVSTJZSA-N |
| XLogP | 1.97 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|