C19H26FN3 — CID 110826343
1-[4-(dimethylamino)phenyl]-N'-[(4-fluorophenyl)methyl]-N,N-dimethylethane-1,2-diamine (PubChem CID 110826343) has the molecular formula C19H26FN3 and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-N'-[(4-fluorophenyl)methyl]-N,N-dimethylethane-1,2-diamine.
| Compound Name | 1-[4-(dimethylamino)phenyl]-N'-[(4-fluorophenyl)methyl]-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 110826343 |
| Molecular Formula | C19H26FN3 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-N'-[(4-fluorophenyl)methyl]-N,N-dimethylethane-1,2-diamine |
| SMILES | CN(C)c1ccc(C(CNCc2ccc(F)cc2)N(C)C)cc1 |
| InChI | InChI=1S/C19H26FN3/c1-22(2)18-11-7-16(8-12-18)19(23(3)4)14-21-13-15-5-9-17(20)10-6-15/h5-12,19,21H,13-14H2,1-4H3 |
| InChIKey | YJKDBWBJOPPPCB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|