C20H34N4O4 — CID 7639297
N'-(2,2-diethoxyethyl)-N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]oxamide (PubChem CID 7639297) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is N'-(2,2-diethoxyethyl)-N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]oxamide.
| Compound Name | N'-(2,2-diethoxyethyl)-N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]oxamide |
|---|---|
| PubChem CID | 7639297 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | N'-(2,2-diethoxyethyl)-N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]oxamide |
| SMILES | CCOC(CNC(=O)C(=O)NC[C@H](c1ccc(N(C)C)cc1)N(C)C)OCC |
| InChI | InChI=1S/C20H34N4O4/c1-7-27-18(28-8-2)14-22-20(26)19(25)21-13-17(24(5)6)15-9-11-16(12-10-15)23(3)4/h9-12,17-18H,7-8,13-14H2,1-6H3,(H,21,25)(H,22,26)/t17-/m1/s1 |
| InChIKey | IDXZTTXYVHMZTN-QGZVFWFLSA-N |
| XLogP | 0.99 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|