C17H30N4O — CID 7496154
1-tert-butyl-3-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]urea (PubChem CID 7496154) has the molecular formula C17H30N4O and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]urea.
| Compound Name | 1-tert-butyl-3-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 7496154 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 1-tert-butyl-3-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]urea |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)NC(C)(C)C)N(C)C)cc1 |
| InChI | InChI=1S/C17H30N4O/c1-17(2,3)19-16(22)18-12-15(21(6)7)13-8-10-14(11-9-13)20(4)5/h8-11,15H,12H2,1-7H3,(H2,18,19,22)/t15-/m1/s1 |
| InChIKey | RAOZHYJIOZYRJW-OAHLLOKOSA-N |
| XLogP | 2.45 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|