C17H26ClN3O2 — CID 84587623
1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea (PubChem CID 84587623) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea.
| Compound Name | 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea |
|---|---|
| PubChem CID | 84587623 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea |
| SMILES | CN(C)C(CNC(=O)NC(C)(CO)C1CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H26ClN3O2/c1-17(11-22,13-6-7-13)20-16(23)19-10-15(21(2)3)12-4-8-14(18)9-5-12/h4-5,8-9,13,15,22H,6-7,10-11H2,1-3H3,(H2,19,20,23) |
| InChIKey | ULTZZJKEUBLZNQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |