C11H18ClN3O — CID 3032080
2-[4-(dimethylamino)phenyl]ethylurea;hydrochloride (PubChem CID 3032080) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]ethylurea;hydrochloride.
| Compound Name | 2-[4-(dimethylamino)phenyl]ethylurea;hydrochloride |
|---|---|
| PubChem CID | 3032080 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]ethylurea;hydrochloride |
| SMILES | CN(C)c1ccc(CCNC(N)=O)cc1.Cl |
| InChI | InChI=1S/C11H17N3O.ClH/c1-14(2)10-5-3-9(4-6-10)7-8-13-11(12)15;/h3-6H,7-8H2,1-2H3,(H3,12,13,15);1H |
| InChIKey | GNOCADYDRHSZNB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|