C19H22ClN3O2 — CID 16891528
N'-(3-chloro-2-methylphenyl)-N-[2-[4-(dimethylamino)phenyl]ethyl]oxamide (PubChem CID 16891528) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is N'-(3-chloro-2-methylphenyl)-N-[2-[4-(dimethylamino)phenyl]ethyl]oxamide.
| Compound Name | N'-(3-chloro-2-methylphenyl)-N-[2-[4-(dimethylamino)phenyl]ethyl]oxamide |
|---|---|
| PubChem CID | 16891528 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N'-(3-chloro-2-methylphenyl)-N-[2-[4-(dimethylamino)phenyl]ethyl]oxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(=O)NCCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-13-16(20)5-4-6-17(13)22-19(25)18(24)21-12-11-14-7-9-15(10-8-14)23(2)3/h4-10H,11-12H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | GRLRACNKAXEPKN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|