C21H24ClN3O3 — CID 16891698
N'-(3-chloro-2-methylphenyl)-N-[2-(4-morpholin-4-ylphenyl)ethyl]oxamide (PubChem CID 16891698) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is N'-(3-chloro-2-methylphenyl)-N-[2-(4-morpholin-4-ylphenyl)ethyl]oxamide.
| Compound Name | N'-(3-chloro-2-methylphenyl)-N-[2-(4-morpholin-4-ylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 16891698 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N'-(3-chloro-2-methylphenyl)-N-[2-(4-morpholin-4-ylphenyl)ethyl]oxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(=O)NCCc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H24ClN3O3/c1-15-18(22)3-2-4-19(15)24-21(27)20(26)23-10-9-16-5-7-17(8-6-16)25-11-13-28-14-12-25/h2-8H,9-14H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | QJGYIGUJXJDGCU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|