C22H26ClN3O2 — CID 16891452
N-[2-[4-(azepan-1-yl)phenyl]ethyl]-N'-(2-chlorophenyl)oxamide (PubChem CID 16891452) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is N-[2-[4-(azepan-1-yl)phenyl]ethyl]-N'-(2-chlorophenyl)oxamide.
| Compound Name | N-[2-[4-(azepan-1-yl)phenyl]ethyl]-N'-(2-chlorophenyl)oxamide |
|---|---|
| PubChem CID | 16891452 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[2-[4-(azepan-1-yl)phenyl]ethyl]-N'-(2-chlorophenyl)oxamide |
| SMILES | O=C(NCCc1ccc(N2CCCCCC2)cc1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H26ClN3O2/c23-19-7-3-4-8-20(19)25-22(28)21(27)24-14-13-17-9-11-18(12-10-17)26-15-5-1-2-6-16-26/h3-4,7-12H,1-2,5-6,13-16H2,(H,24,27)(H,25,28) |
| InChIKey | VNVFKBIOMYTDQC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|