C21H24ClN3O2 — CID 108985822
N-[2-(4-chlorophenyl)ethyl]-N'-(4-piperidin-1-ylphenyl)oxamide (PubChem CID 108985822) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-N'-(4-piperidin-1-ylphenyl)oxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-N'-(4-piperidin-1-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108985822 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-N'-(4-piperidin-1-ylphenyl)oxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H24ClN3O2/c22-17-6-4-16(5-7-17)12-13-23-20(26)21(27)24-18-8-10-19(11-9-18)25-14-2-1-3-15-25/h4-11H,1-3,12-15H2,(H,23,26)(H,24,27) |
| InChIKey | HTADCGWLHMOZFF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|