C17H25N3O2 — CID 108505148
N-butyl-N'-(4-piperidin-1-ylphenyl)oxamide (PubChem CID 108505148) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-butyl-N'-(4-piperidin-1-ylphenyl)oxamide.
| Compound Name | N-butyl-N'-(4-piperidin-1-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108505148 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-butyl-N'-(4-piperidin-1-ylphenyl)oxamide |
| SMILES | CCCCNC(=O)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H25N3O2/c1-2-3-11-18-16(21)17(22)19-14-7-9-15(10-8-14)20-12-5-4-6-13-20/h7-10H,2-6,11-13H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | LICQSICFDXAUSX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|