C21H24F3N4O3+ — CID 2698581
[2-(4-acetamidoanilino)-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylazanium (PubChem CID 2698581) has the molecular formula C21H24F3N4O3+ and a molecular weight of 437.44 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylazanium.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylazanium |
|---|---|
| PubChem CID | 2698581 |
| Molecular Formula | C21H24F3N4O3+ |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylazanium |
| SMILES | CCC[NH+](CC(=O)Nc1ccc(NC(C)=O)cc1)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H23F3N4O3/c1-3-10-28(12-19(31)27-17-9-8-16(22)20(23)21(17)24)11-18(30)26-15-6-4-14(5-7-15)25-13(2)29/h4-9H,3,10-12H2,1-2H3,(H,25,29)(H,26,30)(H,27,31)/p+1 |
| InChIKey | PPRWMYOLUOFWOU-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|