C16H22F3N4O3+ — CID 9433362
ethyl-[2-(ethylamino)-2-oxoethyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium (PubChem CID 9433362) has the molecular formula C16H22F3N4O3+ and a molecular weight of 375.37 g/mol. Its IUPAC name is ethyl-[2-(ethylamino)-2-oxoethyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium.
| Compound Name | ethyl-[2-(ethylamino)-2-oxoethyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 9433362 |
| Molecular Formula | C16H22F3N4O3+ |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | ethyl-[2-(ethylamino)-2-oxoethyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium |
| SMILES | CCNC(=O)C[NH+](CC)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H21F3N4O3/c1-3-20-13(25)8-23(4-2)9-14(26)21-7-12(24)22-11-6-5-10(17)15(18)16(11)19/h5-6H,3-4,7-9H2,1-2H3,(H,20,25)(H,21,26)(H,22,24)/p+1 |
| InChIKey | DBGLSACTCXJPST-UHFFFAOYSA-O |
| XLogP | -0.80 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|