C15H17F3N2O3 — CID 111430472
2-(1-hydroxycyclopentyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide (PubChem CID 111430472) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-(1-hydroxycyclopentyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide.
| Compound Name | 2-(1-hydroxycyclopentyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 111430472 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-(1-hydroxycyclopentyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide |
| SMILES | O=C(CC1(O)CCCC1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H17F3N2O3/c16-9-3-4-10(14(18)13(9)17)20-12(22)8-19-11(21)7-15(23)5-1-2-6-15/h3-4,23H,1-2,5-8H2,(H,19,21)(H,20,22) |
| InChIKey | ZBHYFNRMRSVVMM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|