C18H25F3N3O2+ — CID 9265188
cyclooctyl-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium (PubChem CID 9265188) has the molecular formula C18H25F3N3O2+ and a molecular weight of 372.41 g/mol. Its IUPAC name is cyclooctyl-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium.
| Compound Name | cyclooctyl-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 9265188 |
| Molecular Formula | C18H25F3N3O2+ |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | cyclooctyl-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium |
| SMILES | O=C(C[NH2+]C1CCCCCCC1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H24F3N3O2/c19-13-8-9-14(18(21)17(13)20)24-16(26)11-23-15(25)10-22-12-6-4-2-1-3-5-7-12/h8-9,12,22H,1-7,10-11H2,(H,23,25)(H,24,26)/p+1 |
| InChIKey | IVOSGZUFWCVBGI-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|