C16H23F2N2O+ — CID 9265335
cyclooctyl-[2-(2,4-difluoroanilino)-2-oxoethyl]azanium (PubChem CID 9265335) has the molecular formula C16H23F2N2O+ and a molecular weight of 297.37 g/mol. Its IUPAC name is cyclooctyl-[2-(2,4-difluoroanilino)-2-oxoethyl]azanium.
| Compound Name | cyclooctyl-[2-(2,4-difluoroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9265335 |
| Molecular Formula | C16H23F2N2O+ |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | cyclooctyl-[2-(2,4-difluoroanilino)-2-oxoethyl]azanium |
| SMILES | O=C(C[NH2+]C1CCCCCCC1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H22F2N2O/c17-12-8-9-15(14(18)10-12)20-16(21)11-19-13-6-4-2-1-3-5-7-13/h8-10,13,19H,1-7,11H2,(H,20,21)/p+1 |
| InChIKey | RKNYTWLXROPDKN-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |