C24H29F3N4O2 — CID 24510760
2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide (PubChem CID 24510760) has the molecular formula C24H29F3N4O2 and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide.
| Compound Name | 2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 24510760 |
| Molecular Formula | C24H29F3N4O2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]acetamide |
| SMILES | CN(Cc1ccccc1NCC(=O)NCC(=O)Nc1ccc(F)c(F)c1F)C1CCCCC1 |
| InChI | InChI=1S/C24H29F3N4O2/c1-31(17-8-3-2-4-9-17)15-16-7-5-6-10-19(16)28-13-21(32)29-14-22(33)30-20-12-11-18(25)23(26)24(20)27/h5-7,10-12,17,28H,2-4,8-9,13-15H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | FHYXAFJAERLXSC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|