C18H17F4N3O2 — CID 9034646
2-[[2-[(2-fluorophenyl)methyl-methylamino]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 9034646) has the molecular formula C18H17F4N3O2 and a molecular weight of 383.35 g/mol. Its IUPAC name is 2-[[2-[(2-fluorophenyl)methyl-methylamino]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[(2-fluorophenyl)methyl-methylamino]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 9034646 |
| Molecular Formula | C18H17F4N3O2 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[[2-[(2-fluorophenyl)methyl-methylamino]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN(CC(=O)NCC(=O)Nc1ccc(F)c(F)c1F)Cc1ccccc1F |
| InChI | InChI=1S/C18H17F4N3O2/c1-25(9-11-4-2-3-5-12(11)19)10-16(27)23-8-15(26)24-14-7-6-13(20)17(21)18(14)22/h2-7H,8-10H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | OCSPZJBWFBJYFY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|