C25H34N4O2 — CID 41391031
3-[[2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]acetyl]amino]-N-ethylbenzamide (PubChem CID 41391031) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 3-[[2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]acetyl]amino]-N-ethylbenzamide.
| Compound Name | 3-[[2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]acetyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 41391031 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 3-[[2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]acetyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CNc2ccccc2CN(C)C2CCCCC2)c1 |
| InChI | InChI=1S/C25H34N4O2/c1-3-26-25(31)19-11-9-12-21(16-19)28-24(30)17-27-23-15-8-7-10-20(23)18-29(2)22-13-5-4-6-14-22/h7-12,15-16,22,27H,3-6,13-14,17-18H2,1-2H3,(H,26,31)(H,28,30) |
| InChIKey | KPYVCHOZNXLDCD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |