C21H35N3O — CID 32901720
2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-(2-methylbutan-2-yl)acetamide (PubChem CID 32901720) has the molecular formula C21H35N3O and a molecular weight of 345.53 g/mol. Its IUPAC name is 2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 32901720 |
| Molecular Formula | C21H35N3O |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | 2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(C)NC(=O)CNc1ccccc1CN(C)C1CCCCC1 |
| InChI | InChI=1S/C21H35N3O/c1-5-21(2,3)23-20(25)15-22-19-14-10-9-11-17(19)16-24(4)18-12-7-6-8-13-18/h9-11,14,18,22H,5-8,12-13,15-16H2,1-4H3,(H,23,25) |
| InChIKey | SKTRWKOHRRVKDQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |