C20H30N4O2 — CID 55365381
2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-(cyclopropylcarbamoyl)acetamide (PubChem CID 55365381) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-(cyclopropylcarbamoyl)acetamide.
| Compound Name | 2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-(cyclopropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 55365381 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 2-[2-[[cyclohexyl(methyl)amino]methyl]anilino]-N-(cyclopropylcarbamoyl)acetamide |
| SMILES | CN(Cc1ccccc1NCC(=O)NC(=O)NC1CC1)C1CCCCC1 |
| InChI | InChI=1S/C20H30N4O2/c1-24(17-8-3-2-4-9-17)14-15-7-5-6-10-18(15)21-13-19(25)23-20(26)22-16-11-12-16/h5-7,10,16-17,21H,2-4,8-9,11-14H2,1H3,(H2,22,23,25,26) |
| InChIKey | IQJXQSULPPDHEG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |