C15H20N4O3 — CID 16606580
2-[[2-(cyclopentylcarbamoylamino)-2-oxoethyl]amino]benzamide (PubChem CID 16606580) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[[2-(cyclopentylcarbamoylamino)-2-oxoethyl]amino]benzamide.
| Compound Name | 2-[[2-(cyclopentylcarbamoylamino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 16606580 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[[2-(cyclopentylcarbamoylamino)-2-oxoethyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NCC(=O)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H20N4O3/c16-14(21)11-7-3-4-8-12(11)17-9-13(20)19-15(22)18-10-5-1-2-6-10/h3-4,7-8,10,17H,1-2,5-6,9H2,(H2,16,21)(H2,18,19,20,22) |
| InChIKey | RAUTUDKLQAMZSV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |