C24H37N3O2 — CID 112822832
N-cyclooctyl-2-[2-(3,5-dimethylpiperidine-1-carbonyl)anilino]acetamide (PubChem CID 112822832) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is N-cyclooctyl-2-[2-(3,5-dimethylpiperidine-1-carbonyl)anilino]acetamide.
| Compound Name | N-cyclooctyl-2-[2-(3,5-dimethylpiperidine-1-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 112822832 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | N-cyclooctyl-2-[2-(3,5-dimethylpiperidine-1-carbonyl)anilino]acetamide |
| SMILES | CC1CC(C)CN(C(=O)c2ccccc2NCC(=O)NC2CCCCCCC2)C1 |
| InChI | InChI=1S/C24H37N3O2/c1-18-14-19(2)17-27(16-18)24(29)21-12-8-9-13-22(21)25-15-23(28)26-20-10-6-4-3-5-7-11-20/h8-9,12-13,18-20,25H,3-7,10-11,14-17H2,1-2H3,(H,26,28) |
| InChIKey | RDYKYLRZHRFOGZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |