C18H28N2O3S — CID 131960945
(3,5-dimethylpiperidin-1-yl)-[2-(3-methylsulfonylpropylamino)phenyl]methanone (PubChem CID 131960945) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is (3,5-dimethylpiperidin-1-yl)-[2-(3-methylsulfonylpropylamino)phenyl]methanone.
| Compound Name | (3,5-dimethylpiperidin-1-yl)-[2-(3-methylsulfonylpropylamino)phenyl]methanone |
|---|---|
| PubChem CID | 131960945 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (3,5-dimethylpiperidin-1-yl)-[2-(3-methylsulfonylpropylamino)phenyl]methanone |
| SMILES | CC1CC(C)CN(C(=O)c2ccccc2NCCCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C18H28N2O3S/c1-14-11-15(2)13-20(12-14)18(21)16-7-4-5-8-17(16)19-9-6-10-24(3,22)23/h4-5,7-8,14-15,19H,6,9-13H2,1-3H3 |
| InChIKey | DFDAITOPBDQZRZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|