C19H30ClN3O2 — CID 119717948
N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119717948) has the molecular formula C19H30ClN3O2 and a molecular weight of 367.92 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119717948 |
| Molecular Formula | C19H30ClN3O2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)Nc1ccccc1C(=O)N1CC(C)CC(C)C1.Cl |
| InChI | InChI=1S/C19H29N3O2.ClH/c1-14-11-15(2)13-22(12-14)19(24)16-7-4-5-8-17(16)21-18(23)9-6-10-20-3;/h4-5,7-8,14-15,20H,6,9-13H2,1-3H3,(H,21,23);1H |
| InChIKey | ATCYXVXANWJROJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|