C23H28N4O4 — CID 46442916
N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(2-nitroanilino)propanamide (PubChem CID 46442916) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(2-nitroanilino)propanamide.
| Compound Name | N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 46442916 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(2-nitroanilino)propanamide |
| SMILES | CC1CC(C)CN(C(=O)c2ccccc2NC(=O)CCNc2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C23H28N4O4/c1-16-13-17(2)15-26(14-16)23(29)18-7-3-4-8-19(18)25-22(28)11-12-24-20-9-5-6-10-21(20)27(30)31/h3-10,16-17,24H,11-15H2,1-2H3,(H,25,28) |
| InChIKey | KKSNHFXLSLBZKP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|