C14H21ClN4O3 — CID 119577070
1-(3-methylpiperazin-1-yl)-3-(2-nitroanilino)propan-1-one;hydrochloride (PubChem CID 119577070) has the molecular formula C14H21ClN4O3 and a molecular weight of 328.80 g/mol. Its IUPAC name is 1-(3-methylpiperazin-1-yl)-3-(2-nitroanilino)propan-1-one;hydrochloride.
| Compound Name | 1-(3-methylpiperazin-1-yl)-3-(2-nitroanilino)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119577070 |
| Molecular Formula | C14H21ClN4O3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-(3-methylpiperazin-1-yl)-3-(2-nitroanilino)propan-1-one;hydrochloride |
| SMILES | CC1CN(C(=O)CCNc2ccccc2[N+](=O)[O-])CCN1.Cl |
| InChI | InChI=1S/C14H20N4O3.ClH/c1-11-10-17(9-8-15-11)14(19)6-7-16-12-4-2-3-5-13(12)18(20)21;/h2-5,11,15-16H,6-10H2,1H3;1H |
| InChIKey | SZNNXTRLQSPXBT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|