C19H20F2N4O5S — CID 16622282
1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-(2-nitroanilino)propan-1-one (PubChem CID 16622282) has the molecular formula C19H20F2N4O5S and a molecular weight of 454.46 g/mol. Its IUPAC name is 1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-(2-nitroanilino)propan-1-one.
| Compound Name | 1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-(2-nitroanilino)propan-1-one |
|---|---|
| PubChem CID | 16622282 |
| Molecular Formula | C19H20F2N4O5S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-(2-nitroanilino)propan-1-one |
| SMILES | O=C(CCNc1ccccc1[N+](=O)[O-])N1CCN(S(=O)(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H20F2N4O5S/c20-14-4-3-5-15(21)19(14)31(29,30)24-12-10-23(11-13-24)18(26)8-9-22-16-6-1-2-7-17(16)25(27)28/h1-7,22H,8-13H2 |
| InChIKey | JYVXLYLEGSVPLL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|